C20H20N4O4 — CID 70085230
2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoic acid (PubChem CID 70085230) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoic acid.
| Compound Name | 2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 70085230 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[7-[(4-carbamimidoylbenzoyl)amino]-1-oxo-3,4-dihydroisoquinolin-2-yl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)C(=O)N(C(C)C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C20H20N4O4/c1-11(20(27)28)24-9-8-12-6-7-15(10-16(12)19(24)26)23-18(25)14-4-2-13(3-5-14)17(21)22/h2-7,10-11H,8-9H2,1H3,(H3,21,22)(H,23,25)(H,27,28) |
| InChIKey | NAXJELTXFXCJHL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|