C22H24N4O5 — CID 15483868
3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-4-(methylamino)-4-oxobutanoic acid (PubChem CID 15483868) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-4-(methylamino)-4-oxobutanoic acid.
| Compound Name | 3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-4-(methylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 15483868 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-4-(methylamino)-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc3c(c2)CCN(C(CC(=O)O)C(=O)NC)C3=O)cc1 |
| InChI | InChI=1S/C22H24N4O5/c1-25-21(29)18(11-19(27)28)26-9-8-15-10-16(6-7-17(15)22(26)30)31-12-13-2-4-14(5-3-13)20(23)24/h2-7,10,18H,8-9,11-12H2,1H3,(H3,23,24)(H,25,29)(H,27,28) |
| InChIKey | JFEPQZQWFBIQAV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|