C23H27N3O6 — CID 23377873
3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-3-(2-methoxyethoxy)propanoic acid (PubChem CID 23377873) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-3-(2-methoxyethoxy)propanoic acid.
| Compound Name | 3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-3-(2-methoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 23377873 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-[6-[(4-carbamimidoylphenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]-3-(2-methoxyethoxy)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc3c(c2)CCN(C(CC(=O)O)OCCOC)C3=O)cc1 |
| InChI | InChI=1S/C23H27N3O6/c1-30-10-11-31-20(13-21(27)28)26-9-8-17-12-18(6-7-19(17)23(26)29)32-14-15-2-4-16(5-3-15)22(24)25/h2-7,12,20H,8-11,13-14H2,1H3,(H3,24,25)(H,27,28) |
| InChIKey | OLCWKKXIINZTLA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|