C29H36N2O4 — CID 152590410
butyl 3-[6-[(4-cyanophenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]octanoate (PubChem CID 152590410) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is butyl 3-[6-[(4-cyanophenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]octanoate.
| Compound Name | butyl 3-[6-[(4-cyanophenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]octanoate |
|---|---|
| PubChem CID | 152590410 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | butyl 3-[6-[(4-cyanophenyl)methoxy]-1-oxo-3,4-dihydroisoquinolin-2-yl]octanoate |
| SMILES | CCCCCC(CC(=O)OCCCC)N1CCc2cc(OCc3ccc(C#N)cc3)ccc2C1=O |
| InChI | InChI=1S/C29H36N2O4/c1-3-5-7-8-25(19-28(32)34-17-6-4-2)31-16-15-24-18-26(13-14-27(24)29(31)33)35-21-23-11-9-22(20-30)10-12-23/h9-14,18,25H,3-8,15-17,19,21H2,1-2H3 |
| InChIKey | YVJFTITZQICCEX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|