C28H26F2N4O5 — CID 70066192
2-[7-[(4-carbamimidoylphenyl)methoxy]-1-[(2,4-difluorophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid (PubChem CID 70066192) has the molecular formula C28H26F2N4O5 and a molecular weight of 536.54 g/mol. Its IUPAC name is 2-[7-[(4-carbamimidoylphenyl)methoxy]-1-[(2,4-difluorophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid.
| Compound Name | 2-[7-[(4-carbamimidoylphenyl)methoxy]-1-[(2,4-difluorophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 70066192 |
| Molecular Formula | C28H26F2N4O5 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-[7-[(4-carbamimidoylphenyl)methoxy]-1-[(2,4-difluorophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc3c(c2)C(=O)N(C(CC)C(=O)O)CC(=O)N3Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C28H26F2N4O5/c1-2-23(28(37)38)34-14-25(35)33(13-18-7-8-19(29)11-22(18)30)24-10-9-20(12-21(24)27(34)36)39-15-16-3-5-17(6-4-16)26(31)32/h3-12,23H,2,13-15H2,1H3,(H3,31,32)(H,37,38) |
| InChIKey | GPZBAGCUQQZCHD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|