C28H24N2O4 — CID 141449226
2-[[6-[(4-carbamimidoylphenyl)methoxy]naphthalen-2-yl]methyl]-3-oxo-3-phenylpropanoic acid (PubChem CID 141449226) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[6-[(4-carbamimidoylphenyl)methoxy]naphthalen-2-yl]methyl]-3-oxo-3-phenylpropanoic acid.
| Compound Name | 2-[[6-[(4-carbamimidoylphenyl)methoxy]naphthalen-2-yl]methyl]-3-oxo-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 141449226 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[[6-[(4-carbamimidoylphenyl)methoxy]naphthalen-2-yl]methyl]-3-oxo-3-phenylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc3cc(CC(C(=O)O)C(=O)c4ccccc4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H24N2O4/c29-27(30)21-9-6-18(7-10-21)17-34-24-13-12-22-14-19(8-11-23(22)16-24)15-25(28(32)33)26(31)20-4-2-1-3-5-20/h1-14,16,25H,15,17H2,(H3,29,30)(H,32,33) |
| InChIKey | BOLDCMUVXDAQSR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|