C26H32N4O5 — CID 67706217
ethyl 3-[7-[(3-carbamimidoylphenyl)methoxy]-1-(2-methylpropyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoate (PubChem CID 67706217) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is ethyl 3-[7-[(3-carbamimidoylphenyl)methoxy]-1-(2-methylpropyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoate.
| Compound Name | ethyl 3-[7-[(3-carbamimidoylphenyl)methoxy]-1-(2-methylpropyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoate |
|---|---|
| PubChem CID | 67706217 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | ethyl 3-[7-[(3-carbamimidoylphenyl)methoxy]-1-(2-methylpropyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoate |
| SMILES | [H]/N=C(\N)c1cccc(COc2ccc3c(c2)C(=O)N(CCC(=O)OCC)CC(=O)N3CC(C)C)c1 |
| InChI | InChI=1S/C26H32N4O5/c1-4-34-24(32)10-11-29-15-23(31)30(14-17(2)3)22-9-8-20(13-21(22)26(29)33)35-16-18-6-5-7-19(12-18)25(27)28/h5-9,12-13,17H,4,10-11,14-16H2,1-3H3,(H3,27,28) |
| InChIKey | OYDICACGDDFFLL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|