C31H28N4O6 — CID 10007785
ethyl 3-[1-methyl-2,5-dioxo-7-[2-[4-[(Z)-N'-phenoxycarbonylcarbamimidoyl]phenyl]ethynyl]-3H-1,4-benzodiazepin-4-yl]propanoate (PubChem CID 10007785) has the molecular formula C31H28N4O6 and a molecular weight of 552.59 g/mol. Its IUPAC name is ethyl 3-[1-methyl-2,5-dioxo-7-[2-[4-[(Z)-N'-phenoxycarbonylcarbamimidoyl]phenyl]ethynyl]-3H-1,4-benzodiazepin-4-yl]propanoate.
| Compound Name | ethyl 3-[1-methyl-2,5-dioxo-7-[2-[4-[(Z)-N'-phenoxycarbonylcarbamimidoyl]phenyl]ethynyl]-3H-1,4-benzodiazepin-4-yl]propanoate |
|---|---|
| PubChem CID | 10007785 |
| Molecular Formula | C31H28N4O6 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | ethyl 3-[1-methyl-2,5-dioxo-7-[2-[4-[(Z)-N'-phenoxycarbonylcarbamimidoyl]phenyl]ethynyl]-3H-1,4-benzodiazepin-4-yl]propanoate |
| SMILES | CCOC(=O)CCN1CC(=O)N(C)c2ccc(C#Cc3ccc(/C(N)=N/C(=O)Oc4ccccc4)cc3)cc2C1=O |
| InChI | InChI=1S/C31H28N4O6/c1-3-40-28(37)17-18-35-20-27(36)34(2)26-16-13-22(19-25(26)30(35)38)10-9-21-11-14-23(15-12-21)29(32)33-31(39)41-24-7-5-4-6-8-24/h4-8,11-16,19H,3,17-18,20H2,1-2H3,(H2,32,33,39) |
| InChIKey | IIQJKCUHEUUNCJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|