C27H27N3O4 — CID 70056025
ethyl 3-[7-(5-cyanopent-1-ynyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate (PubChem CID 70056025) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl 3-[7-(5-cyanopent-1-ynyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate.
| Compound Name | ethyl 3-[7-(5-cyanopent-1-ynyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 70056025 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 3-[7-(5-cyanopent-1-ynyl)-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(c1ccccc1)N1CC(=O)N(C)c2ccc(C#CCCCC#N)cc2C1=O |
| InChI | InChI=1S/C27H27N3O4/c1-3-34-26(32)18-24(21-12-8-6-9-13-21)30-19-25(31)29(2)23-15-14-20(17-22(23)27(30)33)11-7-4-5-10-16-28/h6,8-9,12-15,17,24H,3-5,10,18-19H2,1-2H3 |
| InChIKey | NKJUCTOVDKMWMP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|