C37H41N3O6 — CID 70056143
ethyl 3-[1-methyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-ynyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate (PubChem CID 70056143) has the molecular formula C37H41N3O6 and a molecular weight of 623.75 g/mol. Its IUPAC name is ethyl 3-[1-methyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-ynyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate.
| Compound Name | ethyl 3-[1-methyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-ynyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 70056143 |
| Molecular Formula | C37H41N3O6 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | ethyl 3-[1-methyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-ynyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(c1ccccc1)N1C(=O)c2cc(C#CCCCNC(=O)OC(C)(C)C)ccc2N(C)C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C37H41N3O6/c1-6-45-32(41)25-31(27-17-11-7-12-18-27)40-33(28-19-13-8-14-20-28)35(43)39(5)30-22-21-26(24-29(30)34(40)42)16-10-9-15-23-38-36(44)46-37(2,3)4/h7-8,11-14,17-22,24,31,33H,6,9,15,23,25H2,1-5H3,(H,38,44) |
| InChIKey | KDHLWMBOOHWMPA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|