C42H47N3O6 — CID 22904980
ethyl 3-[7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate (PubChem CID 22904980) has the molecular formula C42H47N3O6 and a molecular weight of 689.85 g/mol. Its IUPAC name is ethyl 3-[7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate.
| Compound Name | ethyl 3-[7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22904980 |
| Molecular Formula | C42H47N3O6 |
| Molecular Weight | 689.85 g/mol |
| Exact Mass | 689.35 |
| IUPAC Name | ethyl 3-[7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-1,3-diphenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(c1ccccc1)N1C(=O)c2cc(CCCCCNC(=O)OC(C)(C)C)ccc2N(c2ccccc2)C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C42H47N3O6/c1-5-50-37(46)29-36(31-19-11-6-12-20-31)45-38(32-21-13-7-14-22-32)40(48)44(33-23-15-8-16-24-33)35-26-25-30(28-34(35)39(45)47)18-10-9-17-27-43-41(49)51-42(2,3)4/h6-8,11-16,19-26,28,36,38H,5,9-10,17-18,27,29H2,1-4H3,(H,43,49) |
| InChIKey | VWAZGMGUBYBCQD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.85 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|