C37H45N3O6 — CID 22904969
ethyl 3-[1-benzyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate (PubChem CID 22904969) has the molecular formula C37H45N3O6 and a molecular weight of 627.78 g/mol. Its IUPAC name is ethyl 3-[1-benzyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate.
| Compound Name | ethyl 3-[1-benzyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22904969 |
| Molecular Formula | C37H45N3O6 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | ethyl 3-[1-benzyl-7-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(c1ccccc1)N1CC(=O)N(Cc2ccccc2)c2ccc(CCCCCNC(=O)OC(C)(C)C)cc2C1=O |
| InChI | InChI=1S/C37H45N3O6/c1-5-45-34(42)24-32(29-18-12-7-13-19-29)40-26-33(41)39(25-28-16-9-6-10-17-28)31-21-20-27(23-30(31)35(40)43)15-11-8-14-22-38-36(44)46-37(2,3)4/h6-7,9-10,12-13,16-21,23,32H,5,8,11,14-15,22,24-26H2,1-4H3,(H,38,44) |
| InChIKey | XJQVPEYJVXIRAC-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|