C34H33N3O4 — CID 70056991
ethyl 3-[1-benzyl-7-(5-cyanopent-1-ynyl)-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate (PubChem CID 70056991) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is ethyl 3-[1-benzyl-7-(5-cyanopent-1-ynyl)-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate.
| Compound Name | ethyl 3-[1-benzyl-7-(5-cyanopent-1-ynyl)-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate |
|---|---|
| PubChem CID | 70056991 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | ethyl 3-[1-benzyl-7-(5-cyanopent-1-ynyl)-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate |
| SMILES | CCOC(=O)CC(C)N1C(=O)c2cc(C#CCCCC#N)ccc2N(Cc2ccccc2)C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C34H33N3O4/c1-3-41-31(38)22-25(2)37-32(28-17-11-7-12-18-28)34(40)36(24-27-15-9-6-10-16-27)30-20-19-26(23-29(30)33(37)39)14-8-4-5-13-21-35/h6-7,9-12,15-20,23,25,32H,3-5,13,22,24H2,1-2H3 |
| InChIKey | ZHEBGQRGMXFNBV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|