C30H27N3O6 — CID 70055829
ethyl 3-[1-benzyl-7-[2-(4-nitrophenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoate (PubChem CID 70055829) has the molecular formula C30H27N3O6 and a molecular weight of 525.56 g/mol. Its IUPAC name is ethyl 3-[1-benzyl-7-[2-(4-nitrophenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoate.
| Compound Name | ethyl 3-[1-benzyl-7-[2-(4-nitrophenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoate |
|---|---|
| PubChem CID | 70055829 |
| Molecular Formula | C30H27N3O6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | ethyl 3-[1-benzyl-7-[2-(4-nitrophenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoate |
| SMILES | CCOC(=O)CC(C)N1CC(=O)N(Cc2ccccc2)c2ccc(C#Cc3ccc([N+](=O)[O-])cc3)cc2C1=O |
| InChI | InChI=1S/C30H27N3O6/c1-3-39-29(35)17-21(2)31-20-28(34)32(19-24-7-5-4-6-8-24)27-16-13-23(18-26(27)30(31)36)10-9-22-11-14-25(15-12-22)33(37)38/h4-8,11-16,18,21H,3,17,19-20H2,1-2H3 |
| InChIKey | ZVCFFGKWNOQZSY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|