C25H26N4O6 — CID 19417484
3-[7-(6-aminohex-1-ynyl)-1-[(3-nitrophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 19417484) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is 3-[7-(6-aminohex-1-ynyl)-1-[(3-nitrophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-(6-aminohex-1-ynyl)-1-[(3-nitrophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 19417484 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-[7-(6-aminohex-1-ynyl)-1-[(3-nitrophenyl)methyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | NCCCCC#Cc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N4O6/c26-12-4-2-1-3-6-18-9-10-22-21(15-18)25(33)27(13-11-24(31)32)17-23(30)28(22)16-19-7-5-8-20(14-19)29(34)35/h5,7-10,14-15H,1-2,4,11-13,16-17,26H2,(H,31,32) |
| InChIKey | YKIUXMWNHAKRRO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 147.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|