C18H23N3O4 — CID 19417483
3-[6-(6-aminohex-1-ynyl)-4-methyl-3,8-dioxo-2,7-dihydroquinoxalin-1-yl]propanoic acid (PubChem CID 19417483) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[6-(6-aminohex-1-ynyl)-4-methyl-3,8-dioxo-2,7-dihydroquinoxalin-1-yl]propanoic acid.
| Compound Name | 3-[6-(6-aminohex-1-ynyl)-4-methyl-3,8-dioxo-2,7-dihydroquinoxalin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19417483 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[6-(6-aminohex-1-ynyl)-4-methyl-3,8-dioxo-2,7-dihydroquinoxalin-1-yl]propanoic acid |
| SMILES | CN1C(=O)CN(CCC(=O)O)C2=C1C=C(C#CCCCCN)CC2=O |
| InChI | InChI=1S/C18H23N3O4/c1-20-14-10-13(6-4-2-3-5-8-19)11-15(22)18(14)21(12-16(20)23)9-7-17(24)25/h10H,2-3,5,7-9,11-12,19H2,1H3,(H,24,25) |
| InChIKey | PNKPIJASOJTLPM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|