C26H31N3O5 — CID 22905396
3-[7-(5-aminopentyl)-1-(4-ethylbenzoyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 22905396) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[7-(5-aminopentyl)-1-(4-ethylbenzoyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[7-(5-aminopentyl)-1-(4-ethylbenzoyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 22905396 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-[7-(5-aminopentyl)-1-(4-ethylbenzoyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | CCc1ccc(C(=O)N2C(=O)CN(CCC(=O)O)C(=O)c3cc(CCCCCN)ccc32)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-2-18-7-10-20(11-8-18)25(33)29-22-12-9-19(6-4-3-5-14-27)16-21(22)26(34)28(17-23(29)30)15-13-24(31)32/h7-12,16H,2-6,13-15,17,27H2,1H3,(H,31,32) |
| InChIKey | LKEGMKQBTNOUAI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|