C37H41N3O2 — CID 67817144
7-(6-aminohexyl)-1-benzhydryl-4-(1-phenylpropyl)-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 67817144) has the molecular formula C37H41N3O2 and a molecular weight of 559.75 g/mol. Its IUPAC name is 7-(6-aminohexyl)-1-benzhydryl-4-(1-phenylpropyl)-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 7-(6-aminohexyl)-1-benzhydryl-4-(1-phenylpropyl)-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 67817144 |
| Molecular Formula | C37H41N3O2 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | 7-(6-aminohexyl)-1-benzhydryl-4-(1-phenylpropyl)-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | CCC(c1ccccc1)N1CC(=O)N(C(c2ccccc2)c2ccccc2)c2ccc(CCCCCCN)cc2C1=O |
| InChI | InChI=1S/C37H41N3O2/c1-2-33(29-17-9-5-10-18-29)39-27-35(41)40(36(30-19-11-6-12-20-30)31-21-13-7-14-22-31)34-24-23-28(26-32(34)37(39)42)16-8-3-4-15-25-38/h5-7,9-14,17-24,26,33,36H,2-4,8,15-16,25,27,38H2,1H3 |
| InChIKey | NWHKICLESGQQEY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|