C30H25N3O4 — CID 70054781
ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate (PubChem CID 70054781) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate.
| Compound Name | ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate |
|---|---|
| PubChem CID | 70054781 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | ethyl 3-[7-[2-(3-cyanophenyl)ethynyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]butanoate |
| SMILES | CCOC(=O)CC(C)N1CC(=O)N(c2ccccc2)c2ccc(C#Cc3cccc(C#N)c3)cc2C1=O |
| InChI | InChI=1S/C30H25N3O4/c1-3-37-29(35)16-21(2)32-20-28(34)33(25-10-5-4-6-11-25)27-15-14-23(18-26(27)30(32)36)13-12-22-8-7-9-24(17-22)19-31/h4-11,14-15,17-18,21H,3,16,20H2,1-2H3 |
| InChIKey | SIQRQMFAPRYBGC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|