C18H23IN2O4 — CID 22905085
ethyl 3-(7-iodo-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl)butanoate (PubChem CID 22905085) has the molecular formula C18H23IN2O4 and a molecular weight of 458.30 g/mol. Its IUPAC name is ethyl 3-(7-iodo-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl)butanoate.
| Compound Name | ethyl 3-(7-iodo-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl)butanoate |
|---|---|
| PubChem CID | 22905085 |
| Molecular Formula | C18H23IN2O4 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | ethyl 3-(7-iodo-2,5-dioxo-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl)butanoate |
| SMILES | CCOC(=O)CC(C)N1CC(=O)N(C(C)C)c2ccc(I)cc2C1=O |
| InChI | InChI=1S/C18H23IN2O4/c1-5-25-17(23)8-12(4)20-10-16(22)21(11(2)3)15-7-6-13(19)9-14(15)18(20)24/h6-7,9,11-12H,5,8,10H2,1-4H3 |
| InChIKey | JOYAYOZHHRYHKN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|