C22H17N5O4 — CID 150656307
3-[4-[(6-carbamimidoylnaphthalen-2-yl)carbamoyl]phenyl]-2-oxo-4H-imidazole-5-carboxylic acid (PubChem CID 150656307) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 3-[4-[(6-carbamimidoylnaphthalen-2-yl)carbamoyl]phenyl]-2-oxo-4H-imidazole-5-carboxylic acid.
| Compound Name | 3-[4-[(6-carbamimidoylnaphthalen-2-yl)carbamoyl]phenyl]-2-oxo-4H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 150656307 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-[4-[(6-carbamimidoylnaphthalen-2-yl)carbamoyl]phenyl]-2-oxo-4H-imidazole-5-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc2cc(NC(=O)c3ccc(N4CC(C(=O)O)=NC4=O)cc3)ccc2c1 |
| InChI | InChI=1S/C22H17N5O4/c23-19(24)15-2-1-14-10-16(6-3-13(14)9-15)25-20(28)12-4-7-17(8-5-12)27-11-18(21(29)30)26-22(27)31/h1-10H,11H2,(H3,23,24)(H,25,28)(H,29,30) |
| InChIKey | JCXPXCCXTPVTKV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|