C21H21N3O3 — CID 22370395
methyl 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydronaphthalen-2-yl]acetate (PubChem CID 22370395) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydronaphthalen-2-yl]acetate.
| Compound Name | methyl 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 22370395 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 2-[7-[(4-carbamimidoylphenyl)carbamoyl]-3,4-dihydronaphthalen-2-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccc3c(c2)C=C(CC(=O)OC)CC3)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-27-19(25)11-13-2-3-14-4-5-16(12-17(14)10-13)21(26)24-18-8-6-15(7-9-18)20(22)23/h4-10,12H,2-3,11H2,1H3,(H3,22,23)(H,24,26) |
| InChIKey | PPPYWGSJAPAYQJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|