C22H26ClN3O3 — CID 70053284
ethyl 2-[7-[(4-carbamimidoylbenzoyl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;hydrochloride (PubChem CID 70053284) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is ethyl 2-[7-[(4-carbamimidoylbenzoyl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[7-[(4-carbamimidoylbenzoyl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 70053284 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | ethyl 2-[7-[(4-carbamimidoylbenzoyl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)C(CC(=O)OCC)CCC3)cc1 |
| InChI | InChI=1S/C22H25N3O3.ClH/c1-2-28-20(26)12-17-5-3-4-14-10-11-18(13-19(14)17)25-22(27)16-8-6-15(7-9-16)21(23)24;/h6-11,13,17H,2-5,12H2,1H3,(H3,23,24)(H,25,27);1H |
| InChIKey | DDPQTXWEVFWTJX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|