C25H31N3O4 — CID 18427909
ethyl 2-[6-[[4-(N'-butylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate (PubChem CID 18427909) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 2-[6-[[4-(N'-butylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate.
| Compound Name | ethyl 2-[6-[[4-(N'-butylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate |
|---|---|
| PubChem CID | 18427909 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | ethyl 2-[6-[[4-(N'-butylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate |
| SMILES | CCCC/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)CCC(CC(=O)OCC)O3)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-3-5-14-27-24(26)17-6-8-18(9-7-17)25(30)28-20-11-13-22-19(15-20)10-12-21(32-22)16-23(29)31-4-2/h6-9,11,13,15,21H,3-5,10,12,14,16H2,1-2H3,(H2,26,27)(H,28,30) |
| InChIKey | NHNJAJLTPJVHMZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|