C26H33N3O4 — CID 67652656
[6-[[4-(N'-pentylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl] butanoate (PubChem CID 67652656) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is [6-[[4-(N'-pentylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl] butanoate.
| Compound Name | [6-[[4-(N'-pentylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl] butanoate |
|---|---|
| PubChem CID | 67652656 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | [6-[[4-(N'-pentylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl] butanoate |
| SMILES | CCCCC/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)CCC(OC(=O)CCC)O3)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-5-6-16-28-25(27)18-8-10-19(11-9-18)26(31)29-21-13-14-22-20(17-21)12-15-24(32-22)33-23(30)7-4-2/h8-11,13-14,17,24H,3-7,12,15-16H2,1-2H3,(H2,27,28)(H,29,31) |
| InChIKey | DVMDWACPFDRIIV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|