C20H21NO4 — CID 46586124
butyl 4-(2,3-dihydro-1-benzofuran-5-carbonylamino)benzoate (PubChem CID 46586124) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is butyl 4-(2,3-dihydro-1-benzofuran-5-carbonylamino)benzoate.
| Compound Name | butyl 4-(2,3-dihydro-1-benzofuran-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 46586124 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | butyl 4-(2,3-dihydro-1-benzofuran-5-carbonylamino)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-2-3-11-25-20(23)14-4-7-17(8-5-14)21-19(22)16-6-9-18-15(13-16)10-12-24-18/h4-9,13H,2-3,10-12H2,1H3,(H,21,22) |
| InChIKey | CRSPWNZGBFELCR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|