C23H28N2O4 — CID 46764701
butyl 4-[[3-(morpholin-4-ylmethyl)benzoyl]amino]benzoate (PubChem CID 46764701) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is butyl 4-[[3-(morpholin-4-ylmethyl)benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[3-(morpholin-4-ylmethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 46764701 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | butyl 4-[[3-(morpholin-4-ylmethyl)benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cccc(CN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-3-13-29-23(27)19-7-9-21(10-8-19)24-22(26)20-6-4-5-18(16-20)17-25-11-14-28-15-12-25/h4-10,16H,2-3,11-15,17H2,1H3,(H,24,26) |
| InChIKey | XQFWLYYCXPXSQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|