C23H27N3O4 — CID 18427889
ethyl 2-[6-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate (PubChem CID 18427889) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl 2-[6-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate.
| Compound Name | ethyl 2-[6-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate |
|---|---|
| PubChem CID | 18427889 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 2-[6-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-3,4-dihydro-2H-chromen-2-yl]acetate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc3c(c2)CCC(CC(=O)OCC)O3)cc1)N(C)C |
| InChI | InChI=1S/C23H27N3O4/c1-4-29-21(27)14-19-11-9-17-13-18(10-12-20(17)30-19)25-23(28)16-7-5-15(6-8-16)22(24)26(2)3/h5-8,10,12-13,19,24H,4,9,11,14H2,1-3H3,(H,25,28)/b24-22- |
| InChIKey | IZJNAIBTXFWSBI-GYHWCHFESA-N |
| XLogP | 3.47 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|