About ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane
ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane (PubChem CID 142101154) has the molecular formula C20H33NO4
and a molecular weight of 351.49 g/mol. Its IUPAC name is ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane.
Molecular Properties
| Compound Name | ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane |
| PubChem CID | 142101154 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane |
| SMILES | CC.CCC.CCOC(=O)CC1CCc2cc(NC(C)=O)ccc2O1 |
| InChI | InChI=1S/C15H19NO4.C3H8.C2H6/c1-3-19-15(18)9-13-6-4-11-8-12(16-10(2)17)5-7-14(11)20-13;1-3-2;1-2/h5,7-8,13H,3-4,6,9H2,1-2H3,(H,16,17);3H2,1-2H3;1-2H3 |
| InChIKey | PGSKNURDRLWGPO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane?
The IUPAC name of ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane (CID 142101154) is ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane.
What is the SMILES notation for ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane?
The canonical SMILES for ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane is CC.CCC.CCOC(=O)CC1CCc2cc(NC(C)=O)ccc2O1.
What is the InChIKey of ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane?
The InChIKey is PGSKNURDRLWGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4.C3H8.C2H6/c1-3-19-15(18)9-13-6-4-11-8-12(16-10(2)17)5-7-14(11)20-13;1-3-2;1-2/h5,7-8,13H,3-4,6,9H2,1-2H3,(H,16,17);3H2,1-2H3;1-2H3.
What are the key properties of ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane?
ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane has a molecular weight of 351.49 g/mol, XLogP of 4.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-(6-acetamido-3,4-dihydro-2H-chromen-2-yl)acetate;propane is sourced from PubChem (CID 142101154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).