C19H21ClFN3O2 — CID 161285547
4-carbamimidoyl-N-(2-ethyl-3,4-dihydro-2H-chromen-6-yl)-2-fluorobenzamide;hydrochloride (PubChem CID 161285547) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is 4-carbamimidoyl-N-(2-ethyl-3,4-dihydro-2H-chromen-6-yl)-2-fluorobenzamide;hydrochloride.
| Compound Name | 4-carbamimidoyl-N-(2-ethyl-3,4-dihydro-2H-chromen-6-yl)-2-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 161285547 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-carbamimidoyl-N-(2-ethyl-3,4-dihydro-2H-chromen-6-yl)-2-fluorobenzamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)CCC(CC)O3)c(F)c1 |
| InChI | InChI=1S/C19H20FN3O2.ClH/c1-2-14-6-3-11-9-13(5-8-17(11)25-14)23-19(24)15-7-4-12(18(21)22)10-16(15)20;/h4-5,7-10,14H,2-3,6H2,1H3,(H3,21,22)(H,23,24);1H |
| InChIKey | UOPJOKKVQOZOGP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|