C22H28N4O4S — CID 144807097
N-[8-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-methoxypyridine-2-carboxamide (PubChem CID 144807097) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[8-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[8-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 144807097 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[8-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-methoxypyridine-2-carboxamide |
| SMILES | [H]/N=C(\N)C(C)(C)S(=O)(=O)CC1CCCc2ccc(NC(=O)c3ccc(OC)cn3)cc21 |
| InChI | InChI=1S/C22H28N4O4S/c1-22(2,21(23)24)31(28,29)13-15-6-4-5-14-7-8-16(11-18(14)15)26-20(27)19-10-9-17(30-3)12-25-19/h7-12,15H,4-6,13H2,1-3H3,(H3,23,24)(H,26,27) |
| InChIKey | DGTKRTGMWJDNHC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|