C20H22F3N5O4S — CID 144807039
N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-(trifluoromethyl)pyrazine-2-carboxamide (PubChem CID 144807039) has the molecular formula C20H22F3N5O4S and a molecular weight of 485.49 g/mol. Its IUPAC name is N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-(trifluoromethyl)pyrazine-2-carboxamide.
| Compound Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-(trifluoromethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 144807039 |
| Molecular Formula | C20H22F3N5O4S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-(trifluoromethyl)pyrazine-2-carboxamide |
| SMILES | [H]/N=C(\N)C(C)(C)S(=O)(=O)CC1CCOc2ccc(NC(=O)c3cnc(C(F)(F)F)cn3)cc21 |
| InChI | InChI=1S/C20H22F3N5O4S/c1-19(2,18(24)25)33(30,31)10-11-5-6-32-15-4-3-12(7-13(11)15)28-17(29)14-8-27-16(9-26-14)20(21,22)23/h3-4,7-9,11H,5-6,10H2,1-2H3,(H3,24,25)(H,28,29) |
| InChIKey | CHWRRDFMPAGXBQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 148.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|