C20H28N4O5S — CID 144807091
N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]formamide;2,4-dimethyl-1,3-oxazole (PubChem CID 144807091) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]formamide;2,4-dimethyl-1,3-oxazole.
| Compound Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]formamide;2,4-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 144807091 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]formamide;2,4-dimethyl-1,3-oxazole |
| SMILES | Cc1coc(C)n1.[H]/N=C(\N)C(C)(C)S(=O)(=O)CC1CCOc2ccc(NC=O)cc21 |
| InChI | InChI=1S/C15H21N3O4S.C5H7NO/c1-15(2,14(16)17)23(20,21)8-10-5-6-22-13-4-3-11(18-9-19)7-12(10)13;1-4-3-7-5(2)6-4/h3-4,7,9-10H,5-6,8H2,1-2H3,(H3,16,17)(H,18,19);3H,1-2H3 |
| InChIKey | OYEGRGAVFYUDSZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 148.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|