C21H31N3O3 — CID 91284604
tert-butyl 2-[[1-cyano-2-[6-(propylamino)-3,4-dihydro-2H-chromen-4-yl]ethyl]amino]acetate (PubChem CID 91284604) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is tert-butyl 2-[[1-cyano-2-[6-(propylamino)-3,4-dihydro-2H-chromen-4-yl]ethyl]amino]acetate.
| Compound Name | tert-butyl 2-[[1-cyano-2-[6-(propylamino)-3,4-dihydro-2H-chromen-4-yl]ethyl]amino]acetate |
|---|---|
| PubChem CID | 91284604 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | tert-butyl 2-[[1-cyano-2-[6-(propylamino)-3,4-dihydro-2H-chromen-4-yl]ethyl]amino]acetate |
| SMILES | CCCNc1ccc2c(c1)C(CC(C#N)NCC(=O)OC(C)(C)C)CCO2 |
| InChI | InChI=1S/C21H31N3O3/c1-5-9-23-16-6-7-19-18(12-16)15(8-10-26-19)11-17(13-22)24-14-20(25)27-21(2,3)4/h6-7,12,15,17,23-24H,5,8-11,14H2,1-4H3 |
| InChIKey | HMRURFNMHLSRFY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|