C23H26N4O5S — CID 144807054
N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-prop-1-ynoxypyridine-2-carboxamide (PubChem CID 144807054) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-prop-1-ynoxypyridine-2-carboxamide.
| Compound Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-prop-1-ynoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 144807054 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[4-[(1-amino-1-imino-2-methylpropan-2-yl)sulfonylmethyl]-3,4-dihydro-2H-chromen-6-yl]-5-prop-1-ynoxypyridine-2-carboxamide |
| SMILES | [H]/N=C(\N)C(C)(C)S(=O)(=O)CC1CCOc2ccc(NC(=O)c3ccc(OC#CC)cn3)cc21 |
| InChI | InChI=1S/C23H26N4O5S/c1-4-10-31-17-6-7-19(26-13-17)21(28)27-16-5-8-20-18(12-16)15(9-11-32-20)14-33(29,30)23(2,3)22(24)25/h5-8,12-13,15H,9,11,14H2,1-3H3,(H3,24,25)(H,27,28) |
| InChIKey | MVRVROIJDWAQHD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|