C21H26FN3O4S — CID 144651879
N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 144651879) has the molecular formula C21H26FN3O4S and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 144651879 |
| Molecular Formula | C21H26FN3O4S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | [H]/N=C(\CCC)C(C)(C)S(=O)(=O)Cc1cc(NC(=O)c2ccc(OC)cn2)ccc1F |
| InChI | InChI=1S/C21H26FN3O4S/c1-5-6-19(23)21(2,3)30(27,28)13-14-11-15(7-9-17(14)22)25-20(26)18-10-8-16(29-4)12-24-18/h7-12,23H,5-6,13H2,1-4H3,(H,25,26)/b23-19+ |
| InChIKey | JWGMGWKKHOANQB-FCDQGJHFSA-N |
| XLogP | 3.99 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|