C20H23F2N3O3S — CID 144651865
5-fluoro-N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]pyridine-2-carboxamide (PubChem CID 144651865) has the molecular formula C20H23F2N3O3S and a molecular weight of 423.49 g/mol. Its IUPAC name is 5-fluoro-N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]pyridine-2-carboxamide.
| Compound Name | 5-fluoro-N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 144651865 |
| Molecular Formula | C20H23F2N3O3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5-fluoro-N-[4-fluoro-3-[(3-imino-2-methylhexan-2-yl)sulfonylmethyl]phenyl]pyridine-2-carboxamide |
| SMILES | [H]/N=C(\CCC)C(C)(C)S(=O)(=O)Cc1cc(NC(=O)c2ccc(F)cn2)ccc1F |
| InChI | InChI=1S/C20H23F2N3O3S/c1-4-5-18(23)20(2,3)29(27,28)12-13-10-15(7-8-16(13)22)25-19(26)17-9-6-14(21)11-24-17/h6-11,23H,4-5,12H2,1-3H3,(H,25,26)/b23-18+ |
| InChIKey | SXOTZHNZWDRRGS-PTGBLXJZSA-N |
| XLogP | 4.13 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|