C23H40FNO4S — CID 145351119
2-[[5-(cyclopropylmethoxy)-2-fluorophenyl]methylsulfonyl]-2-methylpentan-3-imine;ethane;2-methoxypropane (PubChem CID 145351119) has the molecular formula C23H40FNO4S and a molecular weight of 445.64 g/mol. Its IUPAC name is 2-[[5-(cyclopropylmethoxy)-2-fluorophenyl]methylsulfonyl]-2-methylpentan-3-imine;ethane;2-methoxypropane.
| Compound Name | 2-[[5-(cyclopropylmethoxy)-2-fluorophenyl]methylsulfonyl]-2-methylpentan-3-imine;ethane;2-methoxypropane |
|---|---|
| PubChem CID | 145351119 |
| Molecular Formula | C23H40FNO4S |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 2-[[5-(cyclopropylmethoxy)-2-fluorophenyl]methylsulfonyl]-2-methylpentan-3-imine;ethane;2-methoxypropane |
| SMILES | CC.COC(C)C.[H]/N=C(\CC)C(C)(C)S(=O)(=O)Cc1cc(OCC2CC2)ccc1F |
| InChI | InChI=1S/C17H24FNO3S.C4H10O.C2H6/c1-4-16(19)17(2,3)23(20,21)11-13-9-14(7-8-15(13)18)22-10-12-5-6-12;1-4(2)5-3;1-2/h7-9,12,19H,4-6,10-11H2,1-3H3;4H,1-3H3;1-2H3/b19-16+;; |
| InChIKey | HNMISRLUASTRNO-JWZFBPJHSA-N |
| XLogP | 5.81 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|