C18H26FNO3S — CID 145351112
2-[[5-(cyclopropylmethoxy)-2-(fluoromethyl)phenyl]methylsulfonyl]-2-methylpentan-3-imine (PubChem CID 145351112) has the molecular formula C18H26FNO3S and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[[5-(cyclopropylmethoxy)-2-(fluoromethyl)phenyl]methylsulfonyl]-2-methylpentan-3-imine.
| Compound Name | 2-[[5-(cyclopropylmethoxy)-2-(fluoromethyl)phenyl]methylsulfonyl]-2-methylpentan-3-imine |
|---|---|
| PubChem CID | 145351112 |
| Molecular Formula | C18H26FNO3S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[[5-(cyclopropylmethoxy)-2-(fluoromethyl)phenyl]methylsulfonyl]-2-methylpentan-3-imine |
| SMILES | [H]/N=C(\CC)C(C)(C)S(=O)(=O)Cc1cc(OCC2CC2)ccc1CF |
| InChI | InChI=1S/C18H26FNO3S/c1-4-17(20)18(2,3)24(21,22)12-15-9-16(8-7-14(15)10-19)23-11-13-5-6-13/h7-9,13,20H,4-6,10-12H2,1-3H3/b20-17+ |
| InChIKey | LEAJZWTZJJQGIW-LVZFUZTISA-N |
| XLogP | 4.07 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|