C21H33FN2O5S — CID 135198103
ethyl 2-[5-[[(1S)-1-[5-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]sulfamoyl]pentylamino]acetate (PubChem CID 135198103) has the molecular formula C21H33FN2O5S and a molecular weight of 444.57 g/mol. Its IUPAC name is ethyl 2-[5-[[(1S)-1-[5-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]sulfamoyl]pentylamino]acetate.
| Compound Name | ethyl 2-[5-[[(1S)-1-[5-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]sulfamoyl]pentylamino]acetate |
|---|---|
| PubChem CID | 135198103 |
| Molecular Formula | C21H33FN2O5S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | ethyl 2-[5-[[(1S)-1-[5-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]sulfamoyl]pentylamino]acetate |
| SMILES | CCOC(=O)CNCCCCCS(=O)(=O)N[C@@H](C)c1cc(OCC2CC2)ccc1F |
| InChI | InChI=1S/C21H33FN2O5S/c1-3-28-21(25)14-23-11-5-4-6-12-30(26,27)24-16(2)19-13-18(9-10-20(19)22)29-15-17-7-8-17/h9-10,13,16-17,23-24H,3-8,11-12,14-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | HDQJFLCNNLGZHP-INIZCTEOSA-N |
| XLogP | 2.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|