C19H29FN2O5S — CID 135186535
2-[5-[1-[3-(cyclopropylmethoxy)-5-fluorophenyl]ethylsulfamoyl]pentylamino]acetic acid (PubChem CID 135186535) has the molecular formula C19H29FN2O5S and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[5-[1-[3-(cyclopropylmethoxy)-5-fluorophenyl]ethylsulfamoyl]pentylamino]acetic acid.
| Compound Name | 2-[5-[1-[3-(cyclopropylmethoxy)-5-fluorophenyl]ethylsulfamoyl]pentylamino]acetic acid |
|---|---|
| PubChem CID | 135186535 |
| Molecular Formula | C19H29FN2O5S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[5-[1-[3-(cyclopropylmethoxy)-5-fluorophenyl]ethylsulfamoyl]pentylamino]acetic acid |
| SMILES | CC(NS(=O)(=O)CCCCCNCC(=O)O)c1cc(F)cc(OCC2CC2)c1 |
| InChI | InChI=1S/C19H29FN2O5S/c1-14(16-9-17(20)11-18(10-16)27-13-15-5-6-15)22-28(25,26)8-4-2-3-7-21-12-19(23)24/h9-11,14-15,21-22H,2-8,12-13H2,1H3,(H,23,24) |
| InChIKey | XHNGRQCPLYTTIG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|