C21H33FN2O5S — CID 135186512
2-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfamoyl]pentylamino]acetic acid (PubChem CID 135186512) has the molecular formula C21H33FN2O5S and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfamoyl]pentylamino]acetic acid.
| Compound Name | 2-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfamoyl]pentylamino]acetic acid |
|---|---|
| PubChem CID | 135186512 |
| Molecular Formula | C21H33FN2O5S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]sulfamoyl]pentylamino]acetic acid |
| SMILES | CC(C)C(NS(=O)(=O)CCCCCNCC(=O)O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H33FN2O5S/c1-15(2)21(17-8-9-18(22)19(12-17)29-14-16-6-7-16)24-30(27,28)11-5-3-4-10-23-13-20(25)26/h8-9,12,15-16,21,23-24H,3-7,10-11,13-14H2,1-2H3,(H,25,26) |
| InChIKey | OEQPLGLQWCHPKE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|