C19H32FN3O — CID 142361186
5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentan-1-amine (PubChem CID 142361186) has the molecular formula C19H32FN3O and a molecular weight of 337.48 g/mol. Its IUPAC name is 5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentan-1-amine.
| Compound Name | 5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentan-1-amine |
|---|---|
| PubChem CID | 142361186 |
| Molecular Formula | C19H32FN3O |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentan-1-amine |
| SMILES | CC(C)C(NNCCCCCN)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C19H32FN3O/c1-14(2)19(23-22-11-5-3-4-10-21)16-8-9-17(20)18(12-16)24-13-15-6-7-15/h8-9,12,14-15,19,22-23H,3-7,10-11,13,21H2,1-2H3 |
| InChIKey | WABMCISFNOBQCO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|