C22H36FN5O3 — CID 142360453
N-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentyl-(methylcarbamoyl)amino]formamide (PubChem CID 142360453) has the molecular formula C22H36FN5O3 and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentyl-(methylcarbamoyl)amino]formamide.
| Compound Name | N-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentyl-(methylcarbamoyl)amino]formamide |
|---|---|
| PubChem CID | 142360453 |
| Molecular Formula | C22H36FN5O3 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | N-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-methylpropyl]hydrazinyl]pentyl-(methylcarbamoyl)amino]formamide |
| SMILES | CNC(=O)N(CCCCCNNC(c1ccc(F)c(OCC2CC2)c1)C(C)C)NC=O |
| InChI | InChI=1S/C22H36FN5O3/c1-16(2)21(18-9-10-19(23)20(13-18)31-14-17-7-8-17)27-25-11-5-4-6-12-28(26-15-29)22(30)24-3/h9-10,13,15-17,21,25,27H,4-8,11-12,14H2,1-3H3,(H,24,30)(H,26,29) |
| InChIKey | KZZBHCBFPZIUKV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|