C21H35FN2O — CID 142361235
N'-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2,2-dimethylpropyl]hexane-1,6-diamine (PubChem CID 142361235) has the molecular formula C21H35FN2O and a molecular weight of 350.52 g/mol. Its IUPAC name is N'-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2,2-dimethylpropyl]hexane-1,6-diamine.
| Compound Name | N'-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2,2-dimethylpropyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 142361235 |
| Molecular Formula | C21H35FN2O |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | N'-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2,2-dimethylpropyl]hexane-1,6-diamine |
| SMILES | CC(C)(C)C(NCCCCCCN)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H35FN2O/c1-21(2,3)20(24-13-7-5-4-6-12-23)17-10-11-18(22)19(14-17)25-15-16-8-9-16/h10-11,14,16,20,24H,4-9,12-13,15,23H2,1-3H3 |
| InChIKey | JCJIMYNZHLIJKL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|