C26H40F2N2O2 — CID 142399591
1-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-2-(3-ethoxypropyl)hydrazine;ethane (PubChem CID 142399591) has the molecular formula C26H40F2N2O2 and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-2-(3-ethoxypropyl)hydrazine;ethane.
| Compound Name | 1-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-2-(3-ethoxypropyl)hydrazine;ethane |
|---|---|
| PubChem CID | 142399591 |
| Molecular Formula | C26H40F2N2O2 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 1-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-2-(3-ethoxypropyl)hydrazine;ethane |
| SMILES | CC.CC.CCOCCCNNC(c1ccc(F)cc1)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H28F2N2O2.2C2H6/c1-2-27-13-3-12-25-26-22(17-6-9-19(23)10-7-17)18-8-11-20(24)21(14-18)28-15-16-4-5-16;2*1-2/h6-11,14,16,22,25-26H,2-5,12-13,15H2,1H3;2*1-2H3 |
| InChIKey | BHTORMNJXMXBPL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|