C24H36F3NO5S — CID 145227636
ethyl 2-[5-[(3R)-3-[3-(cyclopropylmethoxy)-4-(trifluoromethyl)phenyl]butyl]sulfonylpentylamino]acetate (PubChem CID 145227636) has the molecular formula C24H36F3NO5S and a molecular weight of 507.62 g/mol. Its IUPAC name is ethyl 2-[5-[(3R)-3-[3-(cyclopropylmethoxy)-4-(trifluoromethyl)phenyl]butyl]sulfonylpentylamino]acetate.
| Compound Name | ethyl 2-[5-[(3R)-3-[3-(cyclopropylmethoxy)-4-(trifluoromethyl)phenyl]butyl]sulfonylpentylamino]acetate |
|---|---|
| PubChem CID | 145227636 |
| Molecular Formula | C24H36F3NO5S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | ethyl 2-[5-[(3R)-3-[3-(cyclopropylmethoxy)-4-(trifluoromethyl)phenyl]butyl]sulfonylpentylamino]acetate |
| SMILES | CCOC(=O)CNCCCCCS(=O)(=O)CC[C@@H](C)c1ccc(C(F)(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C24H36F3NO5S/c1-3-32-23(29)16-28-12-5-4-6-13-34(30,31)14-11-18(2)20-9-10-21(24(25,26)27)22(15-20)33-17-19-7-8-19/h9-10,15,18-19,28H,3-8,11-14,16-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | KEBXIHVQUOQONS-GOSISDBHSA-N |
| XLogP | 4.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|