C24H37FN2O8S — CID 154023971
ethyl 2-[3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfamoyl]propoxymethyl-ethoxycarbonylamino]acetate (PubChem CID 154023971) has the molecular formula C24H37FN2O8S and a molecular weight of 532.63 g/mol. Its IUPAC name is ethyl 2-[3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfamoyl]propoxymethyl-ethoxycarbonylamino]acetate.
| Compound Name | ethyl 2-[3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfamoyl]propoxymethyl-ethoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 154023971 |
| Molecular Formula | C24H37FN2O8S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | ethyl 2-[3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfamoyl]propoxymethyl-ethoxycarbonylamino]acetate |
| SMILES | CCOC(=O)CN(COCCCS(=O)(=O)N[C@H](CC)c1ccc(F)c(OCC2CC2)c1)C(=O)OCC |
| InChI | InChI=1S/C24H37FN2O8S/c1-4-21(19-10-11-20(25)22(14-19)35-16-18-8-9-18)26-36(30,31)13-7-12-32-17-27(24(29)34-6-3)15-23(28)33-5-2/h10-11,14,18,21,26H,4-9,12-13,15-17H2,1-3H3/t21-/m1/s1 |
| InChIKey | UTDLNFIYLKLDGC-OAQYLSRUSA-N |
| XLogP | 3.37 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|