C21H22FN5O3 — CID 70234536
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-methoxyethoxy)pyridine-2-carboxamide (PubChem CID 70234536) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-methoxyethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-methoxyethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70234536 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-methoxyethoxy)pyridine-2-carboxamide |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(F)c(CNc3cccnc3N)c2)nc1 |
| InChI | InChI=1S/C21H22FN5O3/c1-29-9-10-30-16-5-7-19(26-13-16)21(28)27-15-4-6-17(22)14(11-15)12-25-18-3-2-8-24-20(18)23/h2-8,11,13,25H,9-10,12H2,1H3,(H2,23,24)(H,27,28) |
| InChIKey | YOKCBGDVEVRFKP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|