C21H23FN6O3 — CID 70235085
N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide (PubChem CID 70235085) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70235085 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[3-[[(2-amino-3-pyridinyl)amino]methyl]-4-fluorophenyl]-5-(2-ethoxyethoxy)pyrazine-2-carboxamide |
| SMILES | CCOCCOc1cnc(C(=O)Nc2ccc(F)c(CNc3cccnc3N)c2)cn1 |
| InChI | InChI=1S/C21H23FN6O3/c1-2-30-8-9-31-19-13-26-18(12-27-19)21(29)28-15-5-6-16(22)14(10-15)11-25-17-4-3-7-24-20(17)23/h3-7,10,12-13,25H,2,8-9,11H2,1H3,(H2,23,24)(H,28,29) |
| InChIKey | YTEPOMDBWCKMJS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|